ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50262-51-6 4-formilfenil hekzanoat |
|
| Ürün Adı | 4-formilfenil hekzanoat |
| Eş anlamlı | ; 4-Formilfenil hekzanoat; hekzanoik asit, 4-formilfenil ester; |
| ingilizce adı | 4-formylphenyl hexanoate;4-Formylphenyl hexanoate;hexanoic acid, 4-formylphenyl ester |
| Moleküler Formülü | C13H16O3 |
| Molekül Ağırlığı | 220.2643 |
| InChI | InChI=1/C13H16O3/c1-2-3-4-5-13(15)16-12-8-6-11(10-14)7-9-12/h6-10H,2-5H2,1H3 |
| CAS kayıt numarası | 50262-51-6 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.075g/cm3 |
| Kaynama noktası | 334.3°C at 760 mmHg |
| Kırılma indisi | 1.526 |
| Alevlenme noktası | 145.9°C |
| Buhar basıncı | 0.000129mmHg at 25°C |
| MSDS | |