ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56652-33-6 5-okso-L-prolin, (9S)-cinchonan-9-ol (1:1) ile bileşik |
|
| Ürün Adı | 5-okso-L-prolin, (9S)-cinchonan-9-ol (1:1) ile bileşik |
| Eş anlamlı | 5-Okso-L-prolin, (9S)-cinchonan-9-ol (1:1) ile bileşik; 5-okso-L-prolin - (9S) -cinchonan-9-ol (1: 1); |
| ingilizce adı | 5-oxo-L-proline, compound with (9S)-cinchonan-9-ol (1:1);5-Oxo-L-proline, compound with (9S)-cinchonan-9-ol (1:1);5-oxo-L-proline - (9S)-cinchonan-9-ol (1:1) |
| Moleküler Formülü | C24H29N3O4 |
| Molekül Ağırlığı | 423.5048 |
| InChI | InChI=1/C19H22N2O.C5H7NO3/c1-2-13-12-21-10-8-14(13)11-18(21)19(22)16-7-9-20-17-6-4-3-5-15(16)17;7-4-2-1-3(6-4)5(8)9/h2-7,9,13-14,18-19,22H,1,8,10-12H2;3H,1-2H2,(H,6,7)(H,8,9)/t13?,14?,18?,19-;3-/m00/s1 |
| CAS kayıt numarası | 56652-33-6 |
| EINECS | 260-313-5 |
| Moleküler Yapısı | ![]() |
| Kaynama noktası | 464.5°C at 760 mmHg |
| Alevlenme noktası | 234.7°C |
| Buhar basıncı | 1.99E-09mmHg at 25°C |
| MSDS | |