ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
57070-71-0 3,4-Diaminobenzofenon monohidroklorür |
|
Ürün Adı | 3,4-Diaminobenzofenon monohidroklorür |
Eş anlamlı | 3,4-Diaminobenzofenon hidroklorür; (3,4-diaminofenil) (fenil) metanon hidroklorür; |
ingilizce adı | 3,4-Diaminobenzophenone monohydrochloride;3,4-Diaminobenzophenone hydrochloride;(3,4-diaminophenyl)(phenyl)methanone hydrochloride |
Moleküler Formülü | C13H13ClN2O |
Molekül Ağırlığı | 248.7081 |
InChI | InChI=1/C13H12N2O.ClH/c14-11-7-6-10(8-12(11)15)13(16)9-4-2-1-3-5-9;/h1-8H,14-15H2;1H |
CAS kayıt numarası | 57070-71-0 |
EINECS | 260-541-5 |
Moleküler Yapısı | ![]() |
Ergime noktası | 210-215℃ |
Kaynama noktası | 440.7°C at 760 mmHg |
Alevlenme noktası | 220.3°C |
Buhar basıncı | 5.76E-08mmHg at 25°C |
Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
MSDS |