ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
589-35-5 3-methylpentan-1-ol |
|
| Ürün Adı | 3-methylpentan-1-ol |
| ingilizce adı | 3-methylpentan-1-ol;1-Pentanol, 3-methyl-;2-Ethyl-4-butanol;3-Ethyl-1-butanol;3-Methyl-1-pentanol;3-Methylpentanol;AI3-38563;EINECS 209-644-9;FEMA No. 3762;NSC 9466;3-Methylpentan-1-ol;(3R)-3-methylpentan-1-ol |
| Moleküler Formülü | C6H14O |
| Molekül Ağırlığı | 102.1748 |
| InChI | InChI=1/C6H14O/c1-3-6(2)4-5-7/h6-7H,3-5H2,1-2H3/t6-/m1/s1 |
| CAS kayıt numarası | 589-35-5;20281-83-8;343268-11-1 |
| EINECS | 209-644-9 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 0.814g/cm3 |
| Kaynama noktası | 153°C at 760 mmHg |
| Kırılma indisi | 1.413 |
| Alevlenme noktası | 58.9°C |
| Buhar basıncı | 1.26mmHg at 25°C |
| MSDS | |