ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59133-51-6 4-amino-N,2-dimethyl-5-phenyl-1H-pyrrole-3-carboxamide hydrochloride |
|
| Ürün Adı | 4-amino-N,2-dimethyl-5-phenyl-1H-pyrrole-3-carboxamide hydrochloride |
| ingilizce adı | 4-amino-N,2-dimethyl-5-phenyl-1H-pyrrole-3-carboxamide hydrochloride; |
| Moleküler Formülü | C13H16ClN3O |
| Molekül Ağırlığı | 265.7386 |
| InChI | InChI=1/C13H15N3O.ClH/c1-8-10(13(17)15-2)11(14)12(16-8)9-6-4-3-5-7-9;/h3-7,16H,14H2,1-2H3,(H,15,17);1H |
| CAS kayıt numarası | 59133-51-6 |
| Moleküler Yapısı | ![]() |
| Kaynama noktası | 400.1°C at 760 mmHg |
| Alevlenme noktası | 195.8°C |
| Buhar basıncı | 1.3E-06mmHg at 25°C |
| MSDS | |