ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
61-33-6 benzylpenicillin |
|
| Ürün Adı | benzylpenicillin |
| ingilizce adı | benzylpenicillin;6-(2-phenylacetamido)penicillanic acid;Penicillin G;Pfizerpen;(2S,5R,6R)-3,3-dimethyl-7-oxo-6-[(phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;(5R,6R)-3,3-dimethyl-7-oxo-6-[(phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| Moleküler Formülü | C16H18N2O4S |
| Molekül Ağırlığı | 334.3901 |
| InChI | InChI=1/C16H18N2O4S/c1-16(2)12(15(21)22)18-13(20)11(14(18)23-16)17-10(19)8-9-6-4-3-5-7-9/h3-7,11-12,14H,8H2,1-2H3,(H,17,19)(H,21,22)/t11-,12?,14-/m1/s1 |
| CAS kayıt numarası | 61-33-6 |
| EINECS | 200-506-3 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.42g/cm3 |
| Kaynama noktası | 663.3°C at 760 mmHg |
| Kırılma indisi | 1.655 |
| Alevlenme noktası | 355°C |
| Buhar basıncı | 1.69E-18mmHg at 25°C |
| MSDS | |