ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
816-80-8 trimetil fosforotritiyoit |
|
| Ürün Adı | trimetil fosforotritiyoit |
| Eş anlamlı | ;p özoforotritik asit, trimetil ester; |
| ingilizce adı | trimethyl phosphorotrithioite;phosphorotrithious acid, trimethyl ester |
| Moleküler Formülü | C3H9PS3 |
| Molekül Ağırlığı | 172.2723 |
| InChI | InChI=1/C3H9PS3/c1-5-4(6-2)7-3/h1-3H3 |
| CAS kayıt numarası | 816-80-8 |
| Moleküler Yapısı | ![]() |
| Kaynama noktası | 232.9°C at 760 mmHg |
| Alevlenme noktası | 94.6°C |
| Buhar basıncı | 0.0877mmHg at 25°C |
| MSDS | |