ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
825-44-5 Thianaphthene-1,1-dioxide |
|
| Ürün Adı | Thianaphthene-1,1-dioxide |
| ingilizce adı | Thianaphthene-1,1-dioxide;Thianaphthene 1,1-dioxide;Benzo[b]thiophene 1,1-dioxide;1-benzothiophene 1,1-dioxide |
| Moleküler Formülü | C8H6O2S |
| Molekül Ağırlığı | 166.197 |
| InChI | InChI=1/C8H6O2S/c9-11(10)6-5-7-3-1-2-4-8(7)11/h1-6H |
| CAS kayıt numarası | 825-44-5 |
| EINECS | 212-544-8 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.403g/cm3 |
| Ergime noktası | 137-138℃ |
| Kaynama noktası | 371.1°C at 760 mmHg |
| Kırılma indisi | 1.64 |
| Alevlenme noktası | 244°C |
| Buhar basıncı | 2.25E-05mmHg at 25°C |
| Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |