ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
878285-12-2 4-chloro-2,3-difluoro-aniline |
|
| Ürün Adı | 4-chloro-2,3-difluoro-aniline |
| ingilizce adı | 4-chloro-2,3-difluoro-aniline; |
| Moleküler Formülü | C6H4ClF2N |
| Molekül Ağırlığı | 163.5524664 |
| InChI | InChI=1/C6H4ClF2N/c7-3-1-2-4(10)6(9)5(3)8/h1-2H,10H2 |
| CAS kayıt numarası | 878285-12-2 |
| Moleküler Yapısı | ![]() |
| MSDS | |