ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88-03-9 2-methylphloroglucinol |
|
| Ürün Adı | 2-methylphloroglucinol |
| ingilizce adı | 2-methylphloroglucinol;2-Methylphloroglucinol;AI3-15974;1,3,5-Benzenetriol, 2-methyl-;2-methylbenzene-1,3,5-triol |
| Moleküler Formülü | C7H8O3 |
| Molekül Ağırlığı | 140.1366 |
| InChI | InChI=1/C7H8O3/c1-4-6(9)2-5(8)3-7(4)10/h2-3,8-10H,1H3 |
| CAS kayıt numarası | 88-03-9 |
| EINECS | 201-792-2 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.387g/cm3 |
| Kaynama noktası | 313.1°C at 760 mmHg |
| Kırılma indisi | 1.647 |
| Alevlenme noktası | 160.6°C |
| Buhar basıncı | 0.000276mmHg at 25°C |
| MSDS | |