ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
29043-07-0 3',4',5,5',6,7-Hexamethoxyflavone |
|
| Chemical Name | 3',4',5,5',6,7-Hexamethoxyflavone |
| Synonyms | 5,6,7,3',4',5'-Hexamethoxyflavone;5,6,7-trimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one |
| Molecular Formula | C21H22O8 |
| Molecular Weight | 402.3946 |
| InChl | InChI=1/C21H22O8/c1-23-15-7-11(8-16(24-2)19(15)26-4)13-9-12(22)18-14(29-13)10-17(25-3)20(27-5)21(18)28-6/h7-10H,1-6H3 |
| CAS Registry Number | 29043-07-0 |
| Molecular Structure | ![]() |
| Density | 1.244g/cm3 |
| Boiling Point | 572.8°C at 760 mmHg |
| Refractive Index | 1.558 |
| Flash Point | 249.9°C |
| Vapour Pressur | 3.95E-13mmHg at 25°C |
| Safety Description | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |