ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
317830-29-8 3-[(1R)-1-aminoethyl]aniline |
|
| Chemical Name | 3-[(1R)-1-aminoethyl]aniline |
| Synonyms | (R)-3-Amino-α-methyl-benzenemethanamine;3-[(1R)-1-Aminoethyl]aniline;benzenemethanamine, 3-amino-α-methyl-, (alphaR)- |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.1943 |
| InChl | InChI=1/C8H12N2/c1-6(9)7-3-2-4-8(10)5-7/h2-6H,9-10H2,1H3/t6-/m1/s1 |
| CAS Registry Number | 317830-29-8 |
| Molecular Structure | ![]() |
| Density | 1.056g/cm3 |
| Boiling Point | 266.5°C at 760 mmHg |
| Refractive Index | 1.59 |
| Flash Point | 135.2°C |
| Vapour Pressur | 0.00863mmHg at 25°C |
| MSDS | |