368870-06-8 1-(4-chlorophenethyl)-5-oxo-3-pyrrolidinecarboxylic acid |
|
| Product Name | 1-(4-chlorophenethyl)-5-oxo-3-pyrrolidinecarboxylic acid |
| Synonyms | 1-[2-(4-chlorophenyl)ethyl]-5-oxopyrrolidine-3-carboxylic acid |
| Molecular Formula | C13H14ClNO3 |
| Molecular Weight | 267.7082 |
| InChl | InChI=1/C13H14ClNO3/c14-11-3-1-9(2-4-11)5-6-15-8-10(13(17)18)7-12(15)16/h1-4,10H,5-8H2,(H,17,18) |
| CAS Registry Number | 368870-06-8 |
| Molecular Structure |  |
| Density | 1.346g/cm3 |
| Melting Point | 148℃ |
| Boiling Point | 496.6°C at 760 mmHg |
| Refractive Index | 1.588 |
| Flash Point | 254.1°C |
| Vapour Pressur | 1.11E-10mmHg at 25°C |
| Hazard Symbols |  Xi##Irritant:; |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
Chemindex > 368870-06-8 1-(4-chlorophenethyl)-5-oxo-3-pyrrolidinecarboxylic acid