ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
37904-84-0 2,6-diphenylcyclohexanone, mixture of cis an |
|
Chemical Name | 2,6-diphenylcyclohexanone, mixture of cis an |
Molecular Formula | C18H18O |
Molecular Weight | 250.3349 |
InChl | InChI=1/C18H18O/c19-18-16(14-8-3-1-4-9-14)12-7-13-17(18)15-10-5-2-6-11-15/h1-6,8-11,16-17H,7,12-13H2 |
CAS Registry Number | 37904-84-0 |
Molecular Structure | ![]() |
Density | 1.082g/cm3 |
Melting Point | 119-121℃ |
Boiling Point | 405.3°C at 760 mmHg |
Refractive Index | 1.577 |
Flash Point | 177.4°C |
Vapour Pressur | 8.85E-07mmHg at 25°C |
MSDS |