ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
39084-87-2 2,2-dichloro-N-(2-ethylphenyl)acetamide |
|
| Chemical Name | 2,2-dichloro-N-(2-ethylphenyl)acetamide |
| Molecular Formula | C10H11Cl2NO |
| Molecular Weight | 232.1064 |
| InChl | InChI=1/C10H11Cl2NO/c1-2-7-5-3-4-6-8(7)13-10(14)9(11)12/h3-6,9H,2H2,1H3,(H,13,14) |
| CAS Registry Number | 39084-87-2 |
| Molecular Structure | ![]() |
| Density | 1.3g/cm3 |
| Boiling Point | 359.5°C at 760 mmHg |
| Refractive Index | 1.583 |
| Flash Point | 171.2°C |
| Vapour Pressur | 2.37E-05mmHg at 25°C |
| MSDS | |