ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
418789-26-1 1-(1,3-benzodioxol-5-yl)-N-(3-fluorobenzyl)methanamine |
|
| Chemical Name | 1-(1,3-benzodioxol-5-yl)-N-(3-fluorobenzyl)methanamine |
| Synonyms | 1-(1,3-Benzodioxol-5-yl)-N-(3-fluorobenzyl)methanamine;1,3-Benzodioxole-5-methanamine, N-[(3-fluorophenyl)methyl]-;Benzo[1,3]dioxol-5-ylmethyl-(3-fluoro-benzyl)-amine |
| Molecular Formula | C15H14FNO2 |
| Molecular Weight | 259.2756 |
| InChl | InChI=1/C15H14FNO2/c16-13-3-1-2-11(6-13)8-17-9-12-4-5-14-15(7-12)19-10-18-14/h1-7,17H,8-10H2 |
| CAS Registry Number | 418789-26-1 |
| Molecular Structure | ![]() |
| Density | 1.251g/cm3 |
| Boiling Point | 364.6°C at 760 mmHg |
| Refractive Index | 1.591 |
| Flash Point | 174.3°C |
| Vapour Pressur | 1.66E-05mmHg at 25°C |
| MSDS | |