55912-20-4 4-Chloro-3-nitrobenzyl alcohol |
|
| Product Name | 4-Chloro-3-nitrobenzyl alcohol |
| Synonyms | 4-Chloro-3-nitrobenzenemethanol |
| Molecular Formula | C7H6ClNO3 |
| Molecular Weight | 187.58 |
| InChl | InChI=1/C7H6ClNO3/c8-6-2-1-5(4-10)3-7(6)9(11)12/h1-3,10H,4H2 |
| CAS Registry Number | 55912-20-4 |
| EINECS | 259-901-4 |
| Molecular Structure |  |
| Melting Point | 61-65℃ |
| Hazard Symbols |  Xi##Irritant:; |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S24/25##Avoid contact with skin and eyes.:; |
Chemindex > 55912-20-4 4-Chloro-3-nitrobenzyl alcohol