ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
6282-68-4 benzyl 6-cyclohexylhexanoate |
|
| Chemical Name | benzyl 6-cyclohexylhexanoate |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.4244 |
| InChl | InChI=1/C19H28O2/c20-19(21-16-18-13-7-2-8-14-18)15-9-3-6-12-17-10-4-1-5-11-17/h2,7-8,13-14,17H,1,3-6,9-12,15-16H2 |
| CAS Registry Number | 6282-68-4 |
| Molecular Structure | ![]() |
| Density | 0.992g/cm3 |
| Boiling Point | 386.5°C at 760 mmHg |
| Refractive Index | 1.506 |
| Flash Point | 123.5°C |
| Vapour Pressur | 3.51E-06mmHg at 25°C |
| MSDS | |