73960-07-3 4-(Difluoromethoxy)benzaldehyde |
|
| Product Name | 4-(Difluoromethoxy)benzaldehyde |
| Synonyms | p-(Difluoromethoxy)benzaldehyde |
| Molecular Formula | C8H6F2O2 |
| Molecular Weight | 172.1288 |
| InChl | InChI=1/C8H6F2O2/c9-8(10)12-7-3-1-6(5-11)2-4-7/h1-5,8H |
| CAS Registry Number | 73960-07-3 |
| EINECS | 277-653-5 |
| Molecular Structure |  |
| Density | 1.262g/cm3 |
| Boiling Point | 234.7°C at 760 mmHg |
| Refractive Index | 1.497 |
| Flash Point | 93.1°C |
| Vapour Pressur | 0.0522mmHg at 25°C |
| Hazard Symbols |  Xi##Irritant:; |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
Chemindex > 73960-07-3 4-(Difluoromethoxy)benzaldehyde