ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
589-98-0 3-Octanol |
|
| Chemical Name | 3-Octanol |
| Synonyms | DL-3-Octanol;ethylpentylcarbinol;n-Amyl ethyl carbinol;Ethyl n-pentyl carbinol;(3S)-octan-3-ol;(±)-octan-3-ol;(3R)-octan-3-ol |
| Molecular Formula | C8H18O |
| Molecular Weight | 130.2279 |
| InChl | InChI=1/C8H18O/c1-3-5-6-7-8(9)4-2/h8-9H,3-7H2,1-2H3/t8-/m0/s1 |
| CAS Registry Number | 589-98-0;20296-29-1 |
| EINECS | 209-667-4 |
| Molecular Structure | ![]() |
| Density | 0.821g/cm3 |
| Melting Point | -45℃ |
| Boiling Point | 169°C at 760 mmHg |
| Refractive Index | 1.426 |
| Flash Point | 65.6°C |
| Vapour Pressur | 0.512mmHg at 25°C |
| Safety Description | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |