589-98-0;20296-29-1 3-Octanol |
| Product Name |
3-Octanol |
| Synonyms |
DL-3-Octanol;ethylpentylcarbinol;n-Amyl ethyl carbinol;Ethyl n-pentyl carbinol;(3S)-octan-3-ol;(±)-octan-3-ol;(3R)-octan-3-ol |
| Molecular Formula |
C8H18O |
| Molecular Weight |
130.2279 |
| InChl |
InChI=1/C8H18O/c1-3-5-6-7-8(9)4-2/h8-9H,3-7H2,1-2H3/t8-/m0/s1 |
| CAS Registry Number |
589-98-0;20296-29-1 |
| EINECS |
209-667-4 |
| Molecular Structure |
 |
| Density |
0.821g/cm3 |
| Melting Point |
-45℃ |
| Boiling Point |
169°C at 760 mmHg |
| Refractive Index |
1.426 |
| Flash Point |
65.6°C |
| Vapour Pressur |
0.512mmHg at 25°C |
| Safety Description |
S24/25##Avoid contact with skin and eyes.:;
|
