ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
101153-84-8 3-methyl-5-oxopentyl acetate |
|
| Chemical Name | 3-methyl-5-oxopentyl acetate |
| Synonyms | 3-Methyl-5-oxopentyl acetate;pentanal, 5-(acetyloxy)-3-methyl- |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.195 |
| InChl | InChI=1/C8H14O3/c1-7(3-5-9)4-6-11-8(2)10/h5,7H,3-4,6H2,1-2H3 |
| CAS Registry Number | 101153-84-8 |
| Molecular Structure | ![]() |
| Density | 0.978g/cm3 |
| Boiling Point | 218.682°C at 760 mmHg |
| Refractive Index | 1.421 |
| Flash Point | 86.92°C |
| Vapour Pressur | 0.124mmHg at 25°C |
| MSDS | |