ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
101153-84-8 3-methyl-5-oxopentylacetaat |
|
| Naam product | 3-methyl-5-oxopentylacetaat |
| Synoniemen | 3-methyl-5-oxopentylacetaat; pentanal, 5-(acetyloxy)-3-methyl- |
| Engelse naam | 3-methyl-5-oxopentyl acetate;3-Methyl-5-oxopentyl acetate;pentanal, 5-(acetyloxy)-3-methyl- |
| MF | C8H14O3 |
| Molecuulgewicht | 158.195 |
| InChI | InChI=1/C8H14O3/c1-7(3-5-9)4-6-11-8(2)10/h5,7H,3-4,6H2,1-2H3 |
| CAS-nummer | 101153-84-8 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 0.978g/cm3 |
| Kookpunt | 218.682°C at 760 mmHg |
| Brekingsindex | 1.421 |
| Vlampunt | 86.92°C |
| Dampdruk | 0.124mmHg at 25°C |
| MSDS | |