ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
102338-95-4 3-piperidin-1-ylpropyl 4-(butylamino)-2-hydroxybenzoate dihydrochloride |
|
| Chemical Name | 3-piperidin-1-ylpropyl 4-(butylamino)-2-hydroxybenzoate dihydrochloride |
| Molecular Formula | C19H32Cl2N2O3 |
| Molecular Weight | 407.375 |
| InChl | InChI=1/C19H30N2O3.2ClH/c1-2-3-10-20-16-8-9-17(18(22)15-16)19(23)24-14-7-13-21-11-5-4-6-12-21;;/h8-9,15,20,22H,2-7,10-14H2,1H3;2*1H |
| CAS Registry Number | 102338-95-4 |
| Molecular Structure | ![]() |
| Boiling Point | 492.2°C at 760 mmHg |
| Flash Point | 251.5°C |
| Vapour Pressur | 2.6E-10mmHg at 25°C |
| MSDS | |