ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
102338-95-4 3-piperidine-1-ylpropyl 4-(butylamino)-2-hydroxybenzoaatdihydrochloride |
|
| Naam product | 3-piperidine-1-ylpropyl 4-(butylamino)-2-hydroxybenzoaatdihydrochloride |
| Engelse naam | 3-piperidin-1-ylpropyl 4-(butylamino)-2-hydroxybenzoate dihydrochloride; |
| MF | C19H32Cl2N2O3 |
| Molecuulgewicht | 407.375 |
| InChI | InChI=1/C19H30N2O3.2ClH/c1-2-3-10-20-16-8-9-17(18(22)15-16)19(23)24-14-7-13-21-11-5-4-6-12-21;;/h8-9,15,20,22H,2-7,10-14H2,1H3;2*1H |
| CAS-nummer | 102338-95-4 |
| Moleculaire Structuur | ![]() |
| Kookpunt | 492.2°C at 760 mmHg |
| Vlampunt | 251.5°C |
| Dampdruk | 2.6E-10mmHg at 25°C |
| MSDS | |