ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1592-20-7 1-(Chloromethyl)-4-Ethenylbenzene |
|
Chemical Name | 1-(Chloromethyl)-4-Ethenylbenzene |
Synonyms | 4-Chloromethyl styrene;4-Vinylbenzylchloride;1-(chloromethyl)-4-ethenyl-benzen;4-Vinylbenzyl chloride;1-(Chloromethyl)-4-ethenyl-Benzene;Chloromethyl styrene;1-(chloromethyl)-3-ethenylbenzene-1-(chloromethyl)-4-ethenylbenzene (1:1);vinylbenzyl chloride, mixture of isomers;Chloromethylstyrene;Chloromethylstyrene (m- and p-mixture) (stabilized with TBC);VBC |
Molecular Formula | C9H9Cl |
Molecular Weight | 152.62 |
InChl | InChI=1/C9H9Cl/c1-2-8-3-5-9(7-10)6-4-8/h2-6H,1,7H2 |
CAS Registry Number | 1592-20-7;30030-25-2 |
EINECS | 216-471-2 |
Molecular Structure | ![]() |
Density | 1.083 |
Boiling Point | 229℃ |
Refractive Index | 1.5731-1.5751 |
Flash Point | 105℃ |
Hazard Symbols | |
Risk Codes | R21/22||R34||R43:; |
Safety Description | S26||S36/37/39||S45:; |
MSDS |