ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1592-20-7 1-(Chloromethyl)-4-Ethenylbenzene |
|
उत्पाद का नाम | 1-(Chloromethyl)-4-Ethenylbenzene |
अंग्रेज | 1-(Chloromethyl)-4-Ethenylbenzene;4-Chloromethyl styrene;4-Vinylbenzylchloride;1-(chloromethyl)-4-ethenyl-benzen;4-Vinylbenzyl chloride;1-(Chloromethyl)-4-ethenyl-Benzene;Chloromethyl styrene;1-(chloromethyl)-3-ethenylbenzene-1-(chloromethyl)-4-ethenylbenzene (1:1);vinylbenzyl chloride, mixture of isomers;Chloromethylstyrene;Chloromethylstyrene (m- and p-mixture) (stabilized with TBC);VBC |
आणविक फार्मूला | C9H9Cl |
आण्विक वजन | 152.62 |
InChI | InChI=1/C9H9Cl/c1-2-8-3-5-9(7-10)6-4-8/h2-6H,1,7H2 |
कैस रजिस्टी संख्या | 1592-20-7;30030-25-2 |
EINECS | 216-471-2 |
आणविक संरचना | ![]() |
घनत्व | 1.083 |
उबलने का समय | 229℃ |
अपवर्तक सूचकांक | 1.5731-1.5751 |
फ्लैश प्वाइंट | 105℃ |
खतरा प्रतीक | |
खतरे के कोड | R21/22||R34||R43:; |
सुरक्षा विवरण | S26||S36/37/39||S45:; |
MSDS |