ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
330466-14-3 (2R)-4-[(3-chloro-2-methylphenyl)amino]-4-oxo-2-[(2S)-tetrahydrofuran-2-yl]butanoate |
|
| Chemical Name | (2R)-4-[(3-chloro-2-methylphenyl)amino]-4-oxo-2-[(2S)-tetrahydrofuran-2-yl]butanoate |
| Molecular Formula | C15H17ClNO4 |
| Molecular Weight | 310.7533 |
| InChl | InChI=1/C15H18ClNO4/c1-9-11(16)4-2-5-12(9)17-14(18)8-10(15(19)20)13-6-3-7-21-13/h2,4-5,10,13H,3,6-8H2,1H3,(H,17,18)(H,19,20)/p-1/t10-,13+/m1/s1 |
| CAS Registry Number | 330466-14-3 |
| Boiling Point | 534.7°C at 760 mmHg |
| Flash Point | 277.2°C |
| Vapour Pressur | 2.89E-12mmHg at 25°C |
| MSDS | |