ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
330466-14-3 (2R)-4-[(3-kloro-2-metilfenil)amino]-4-oxo-2-[(2S)-tetrahydrofuran-2-yl]butanoat |
|
| Nama produk | (2R)-4-[(3-kloro-2-metilfenil)amino]-4-oxo-2-[(2S)-tetrahydrofuran-2-yl]butanoat |
| Sinonim | ; |
| Nama Inggeris | (2R)-4-[(3-chloro-2-methylphenyl)amino]-4-oxo-2-[(2S)-tetrahydrofuran-2-yl]butanoate; |
| MF | C15H17ClNO4 |
| Berat Molekul | 310.7533 |
| InChI | InChI=1/C15H18ClNO4/c1-9-11(16)4-2-5-12(9)17-14(18)8-10(15(19)20)13-6-3-7-21-13/h2,4-5,10,13H,3,6-8H2,1H3,(H,17,18)(H,19,20)/p-1/t10-,13+/m1/s1 |
| CAS NO | 330466-14-3 |
| Titik didih | 534.7°C at 760 mmHg |
| Titik nyala | 277.2°C |
| Tekanan wap | 2.89E-12mmHg at 25°C |
| MSDS | |