ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
348169-39-1 4-bromo-2-methoxy-6-methyl-aniline |
|
| Chemical Name | 4-bromo-2-methoxy-6-methyl-aniline |
| Synonyms | 2-Amino-5-bromo-3-methylanisole |
| Molecular Formula | C8H10BrNO |
| Molecular Weight | 216.0751 |
| InChl | InChI=1/C8H10BrNO/c1-5-3-6(9)4-7(11-2)8(5)10/h3-4H,10H2,1-2H3 |
| CAS Registry Number | 348169-39-1 |
| Molecular Structure | ![]() |
| Density | 1.458g/cm3 |
| Boiling Point | 271.037°C at 760 mmHg |
| Refractive Index | 1.585 |
| Flash Point | 117.719°C |
| Vapour Pressur | 0.007mmHg at 25°C |
| MSDS | |