ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
348169-39-1 4-bromo-2-methoxy-6-methyl-aniline |
|
| Naam product | 4-bromo-2-methoxy-6-methyl-aniline |
| Engelse naam | 4-bromo-2-methoxy-6-methyl-aniline;2-Amino-5-bromo-3-methylanisole |
| MF | C8H10BrNO |
| Molecuulgewicht | 216.0751 |
| InChI | InChI=1/C8H10BrNO/c1-5-3-6(9)4-7(11-2)8(5)10/h3-4H,10H2,1-2H3 |
| CAS-nummer | 348169-39-1 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.458g/cm3 |
| Kookpunt | 271.037°C at 760 mmHg |
| Brekingsindex | 1.585 |
| Vlampunt | 117.719°C |
| Dampdruk | 0.007mmHg at 25°C |
| MSDS | |