3770-82-9 1,3-Dibenzoylbenzene |
| Product Name |
1,3-Dibenzoylbenzene |
| Synonyms |
3-Benzoylbenzophenone;benzene-1,3-diylbis(phenylmethanone) |
| Molecular Formula |
C20H14O2 |
| Molecular Weight |
286.324 |
| InChl |
InChI=1/C20H14O2/c21-19(15-8-3-1-4-9-15)17-12-7-13-18(14-17)20(22)16-10-5-2-6-11-16/h1-14H |
| CAS Registry Number |
3770-82-9 |
| EINECS |
223-210-6 |
| Molecular Structure |
 |
| Density |
1.165g/cm3 |
| Melting Point |
98-108℃ |
| Boiling Point |
467.5°C at 760 mmHg |
| Refractive Index |
1.615 |
| Flash Point |
173.8°C |
| Vapour Pressur |
6.49E-09mmHg at 25°C |
| Safety Description |
S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:;
|
