ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3770-82-9 1,3-Dibenzoylbenzene |
|
Naam product | 1,3-Dibenzoylbenzene |
Engelse naam | 1,3-Dibenzoylbenzene;3-Benzoylbenzophenone;benzene-1,3-diylbis(phenylmethanone) |
MF | C20H14O2 |
Molecuulgewicht | 286.324 |
InChI | InChI=1/C20H14O2/c21-19(15-8-3-1-4-9-15)17-12-7-13-18(14-17)20(22)16-10-5-2-6-11-16/h1-14H |
CAS-nummer | 3770-82-9 |
EINECS | 223-210-6 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.165g/cm3 |
Smeltpunt | 98-108℃ |
Kookpunt | 467.5°C at 760 mmHg |
Brekingsindex | 1.615 |
Vlampunt | 173.8°C |
Dampdruk | 6.49E-09mmHg at 25°C |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |