50-66-8 6-(Methylthio)purine |
| Product Name |
6-(Methylthio)purine |
| Synonyms |
6-(Methylmercapto)purine;6-(Methylsulfanyl)-9H-purine;6-(methylsulfanyl)-7H-purine;6-(methylsulfanyl)-5H-purine |
| Molecular Formula |
C6H6N4S |
| Molecular Weight |
166.2036 |
| InChl |
InChI=1/C6H6N4S/c1-11-6-4-5(8-2-7-4)9-3-10-6/h2-4H,1H3 |
| CAS Registry Number |
50-66-8 |
| EINECS |
200-057-3 |
| Molecular Structure |
 |
| Density |
1.59g/cm3 |
| Melting Point |
221-222℃ |
| Boiling Point |
290.9°C at 760 mmHg |
| Refractive Index |
1.806 |
| Flash Point |
129.7°C |
| Vapour Pressur |
0.00351mmHg at 25°C |
| Safety Description |
S24/25##Avoid contact with skin and eyes.:;
|
