ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 53036-49-0 5-oxo-L-proline, compound with dodecyl 3-hydroxy-L-tyrosinate (1:1) | |
| Chemical Name | 5-oxo-L-proline, compound with dodecyl 3-hydroxy-L-tyrosinate (1:1) | 
| Synonyms | 5-Oxo-L-proline, compound with dodecyl 3-hydroxy-L-tyrosinate (1:1);5-oxo-L-proline - dodecyl 3-hydroxy-L-tyrosinate (1:1) | 
| Molecular Formula | C26H42N2O7 | 
| Molecular Weight | 494.6209 | 
| InChl | InChI=1/C21H35NO4.C5H7NO3/c1-2-3-4-5-6-7-8-9-10-11-14-26-21(25)18(22)15-17-12-13-19(23)20(24)16-17;7-4-2-1-3(6-4)5(8)9/h12-13,16,18,23-24H,2-11,14-15,22H2,1H3;3H,1-2H2,(H,6,7)(H,8,9)/t18-;3-/m00/s1 | 
| CAS Registry Number | 53036-49-0 | 
| EINECS | 258-317-7 | 
| Molecular Structure |  | 
| Boiling Point | 508.7°C at 760 mmHg | 
| Flash Point | 261.4°C | 
| Vapour Pressur | 5.71E-11mmHg at 25°C | 
| MSDS | |