ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
53036-49-0 5-옥소-L-프롤린, 도데실 3-히드록시-L-티로시네이트 화합물(1:1) |
|
| 상품명칭 | 5-옥소-L-프롤린, 도데실 3-히드록시-L-티로시네이트 화합물(1:1) |
| 별명 | 5-옥소-L-프롤린, 도데실 3-하이드록시-L-티로시네이트(1:1)와 화합물; 5-옥소-L-프롤린-도데실 3-하이드록시-L-티로시네이트(1:1); |
| 영문 이름 | 5-oxo-L-proline, compound with dodecyl 3-hydroxy-L-tyrosinate (1:1);5-Oxo-L-proline, compound with dodecyl 3-hydroxy-L-tyrosinate (1:1);5-oxo-L-proline - dodecyl 3-hydroxy-L-tyrosinate (1:1) |
| 분자식 | C26H42N2O7 |
| 분자량 | 494.6209 |
| InChI | InChI=1/C21H35NO4.C5H7NO3/c1-2-3-4-5-6-7-8-9-10-11-14-26-21(25)18(22)15-17-12-13-19(23)20(24)16-17;7-4-2-1-3(6-4)5(8)9/h12-13,16,18,23-24H,2-11,14-15,22H2,1H3;3H,1-2H2,(H,6,7)(H,8,9)/t18-;3-/m00/s1 |
| cas번호 | 53036-49-0 |
| EC번호 | 258-317-7 |
| 분자 구조 | ![]() |
| 비등점 | 508.7°C at 760 mmHg |
| 인화점 | 261.4°C |
| 증기압 | 5.71E-11mmHg at 25°C |
| MSDS | |