ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
53537-62-5 3(or 5)-chloro[1,1'-biphenyl]-2-ol |
|
Chemical Name | 3(or 5)-chloro[1,1'-biphenyl]-2-ol |
Synonyms | 3(or 5)-Chloro(1,1'-biphenyl)-2-ol;4(or 6)-Chloro-2-phenylphenol;Dowicide 31;(1,1'-Biphenyl)-2-ol, 3(or 5)-chloro-;(1,1'-Biphenyl)-2-ol, 5-chloro-, sodium salt (40%), mixture with sodium salts of (1,1'-biphenyl)-2-ol (20%) and 3-chloro(1,1'-biphenyl)-2-ol (12%) in water |
Molecular Formula | C12H9ClO |
Molecular Weight | 204.6551 |
InChl | InChI=1/C12H9ClO/c13-11-8-4-7-10(12(11)14)9-5-2-1-3-6-9/h1-8,14H |
CAS Registry Number | 53537-62-5 |
EINECS | 258-616-2 |
Molecular Structure | ![]() |
MSDS |