Chemindex > 53537-62-5
IL ▼
53537-62-5 3(or 5)-chloro[1,1'-biphenyl]-2-ol |
|
| שם המוצר | 3(or 5)-chloro[1,1'-biphenyl]-2-ol |
| שם אנגלי | 3(or 5)-chloro[1,1'-biphenyl]-2-ol;3(or 5)-Chloro(1,1'-biphenyl)-2-ol;4(or 6)-Chloro-2-phenylphenol;Dowicide 31;(1,1'-Biphenyl)-2-ol, 3(or 5)-chloro-;(1,1'-Biphenyl)-2-ol, 5-chloro-, sodium salt (40%), mixture with sodium salts of (1,1'-biphenyl)-2-ol (20%) and 3-chloro(1,1'-biphenyl)-2-ol (12%) in water |
| מולקולרית פורמולה | C12H9ClO |
| משקל מולקולרי | 204.6551 |
| InChl | InChI=1/C12H9ClO/c13-11-8-4-7-10(12(11)14)9-5-2-1-3-6-9/h1-8,14H |
| מספר CAS | 53537-62-5 |
| EINECS | 258-616-2 |
| מבנה מולקולרי | ![53537-62-5 3(or 5)-chloro[1,1'-biphenyl]-2-ol](https://images-a.chemnet.com/suppliers/chembase/cas4/cas53537-62-5.gif "53537-62-5 3(or 5)-chloro[1,1'-biphenyl]-2-ol") |
| MSDS | |
- אם אתם מתכננים מקור כימיקלים מסין, פשוט לכו לקניון ChemNet, נקבל את המחיר העדכני והתחרותי ביותר מיצרנים מסין עבורכם.אנא בקרו באתר
ChemNet Mall
ספקים עבור 53537-62-5 (0):
שירות מסד הנתונים של CAS כימי מסופק ע& 