ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 56652-27-8 5-oxo-L-proline, compound with (8α,9R)-cinchonan-9-ol (1:1) | |
| Chemical Name | 5-oxo-L-proline, compound with (8α,9R)-cinchonan-9-ol (1:1) | 
| Synonyms | 5-Oxo-L-proline, compound with (8alpha,9R)-cinchonan-9-ol (1:1);5-oxo-L-proline - cinchonan-9-ol (1:1) | 
| Molecular Formula | C24H29N3O4 | 
| Molecular Weight | 423.5048 | 
| InChl | InChI=1/C19H22N2O.C5H7NO3/c1-2-13-12-21-10-8-14(13)11-18(21)19(22)16-7-9-20-17-6-4-3-5-15(16)17;7-4-2-1-3(6-4)5(8)9/h2-7,9,13-14,18-19,22H,1,8,10-12H2;3H,1-2H2,(H,6,7)(H,8,9)/t;3-/m.0/s1 | 
| CAS Registry Number | 56652-27-8 | 
| EINECS | 260-310-9 | 
| Molecular Structure |  | 
| Boiling Point | 464.5°C at 760 mmHg | 
| Flash Point | 234.7°C | 
| Vapour Pressur | 1.99E-09mmHg at 25°C | 
| MSDS | |