ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56652-27-8 5-okso-L-prolin, senyawa dengan (8α,9R)-cinchonan-9-ol (1:1) |
|
| Nama produk | 5-okso-L-prolin, senyawa dengan (8α,9R)-cinchonan-9-ol (1:1) |
| Sinonim | 5-Oxo-L-prolin, senyawa dengan (8alpha,9R)-cinchonan-9-ol (1:1); 5-okso-L-prolin - cinchonan-9-ol (1:1); |
| Nama bahasa Inggris | 5-oxo-L-proline, compound with (8α,9R)-cinchonan-9-ol (1:1);5-Oxo-L-proline, compound with (8alpha,9R)-cinchonan-9-ol (1:1);5-oxo-L-proline - cinchonan-9-ol (1:1) |
| MF | C24H29N3O4 |
| Berat Molekul | 423.5048 |
| InChI | InChI=1/C19H22N2O.C5H7NO3/c1-2-13-12-21-10-8-14(13)11-18(21)19(22)16-7-9-20-17-6-4-3-5-15(16)17;7-4-2-1-3(6-4)5(8)9/h2-7,9,13-14,18-19,22H,1,8,10-12H2;3H,1-2H2,(H,6,7)(H,8,9)/t;3-/m.0/s1 |
| CAS NO | 56652-27-8 |
| EINECS | 260-310-9 |
| Struktur Molekul | ![]() |
| Titik didih | 464.5°C at 760 mmHg |
| Titik nyala | 234.7°C |
| Tekanan uap | 1.99E-09mmHg at 25°C |
| MSDS | |