ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
58561-47-0 9-Octadecenoic acid, 12-hydroxy-, [R-(Z)]-, ester with 1,2,3-propanetriol |
|
| Chemical Name | 9-Octadecenoic acid, 12-hydroxy-, [R-(Z)]-, ester with 1,2,3-propanetriol |
| Synonyms | 9-Octadecenoic acid, 12-hydroxy-, (R-(Z))-, ester with 1,2,3-propanetriol;2,3-dihydroxypropyl 5-hydroxy-2-octyldodecanoate |
| Molecular Formula | C23H46O5 |
| Molecular Weight | 402.6083 |
| InChl | InChI=1/C23H46O5/c1-3-5-7-9-11-12-14-20(23(27)28-19-22(26)18-24)16-17-21(25)15-13-10-8-6-4-2/h20-22,24-26H,3-19H2,1-2H3 |
| CAS Registry Number | 58561-47-0 |
| EINECS | 261-327-4 |
| Molecular Structure | ![]() |
| Density | 0.993g/cm3 |
| Boiling Point | 530.1°C at 760 mmHg |
| Refractive Index | 1.478 |
| Flash Point | 167.3°C |
| Vapour Pressur | 1.89E-13mmHg at 25°C |
| MSDS | |