ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
58561-47-0 Asam 9-Oktadecenoic, 12-hidroksi-, [R-(Z)]-, ester dengan 1,2,3-propanatriol |
|
| Nama produk | Asam 9-Oktadecenoic, 12-hidroksi-, [R-(Z)]-, ester dengan 1,2,3-propanatriol |
| Sinonim | Asam 9-Octadecenoic, 12-hidroksi-, (R-(Z))-, ester dengan 1,2,3-propanatriol; 2,3-dihidroksipropil 5-hidroksi-2-oktildodekanoat; |
| Nama bahasa Inggris | 9-Octadecenoic acid, 12-hydroxy-, [R-(Z)]-, ester with 1,2,3-propanetriol;9-Octadecenoic acid, 12-hydroxy-, (R-(Z))-, ester with 1,2,3-propanetriol;2,3-dihydroxypropyl 5-hydroxy-2-octyldodecanoate |
| MF | C23H46O5 |
| Berat Molekul | 402.6083 |
| InChI | InChI=1/C23H46O5/c1-3-5-7-9-11-12-14-20(23(27)28-19-22(26)18-24)16-17-21(25)15-13-10-8-6-4-2/h20-22,24-26H,3-19H2,1-2H3 |
| CAS NO | 58561-47-0 |
| EINECS | 261-327-4 |
| Struktur Molekul | ![]() |
| Kepadatan | 0.993g/cm3 |
| Titik didih | 530.1°C at 760 mmHg |
| Indeks bias | 1.478 |
| Titik nyala | 167.3°C |
| Tekanan uap | 1.89E-13mmHg at 25°C |
| MSDS | |