ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 59404-75-0 5-oxo-DL-proline, compound with dodecyl DL-alaninate (1:1) | |
| Chemical Name | 5-oxo-DL-proline, compound with dodecyl DL-alaninate (1:1) | 
| Synonyms | 5-Oxo-DL-proline, compound with dodecyl DL-alaninate (1:1);5-oxoproline - dodecyl alaninate (1:1) | 
| Molecular Formula | C20H38N2O5 | 
| Molecular Weight | 386.5261 | 
| InChl | InChI=1/C15H31NO2.C5H7NO3/c1-3-4-5-6-7-8-9-10-11-12-13-18-15(17)14(2)16;7-4-2-1-3(6-4)5(8)9/h14H,3-13,16H2,1-2H3;3H,1-2H2,(H,6,7)(H,8,9) | 
| CAS Registry Number | 59404-75-0 | 
| EINECS | 261-737-3 | 
| Molecular Structure |  | 
| Boiling Point | 327.2°C at 760 mmHg | 
| Flash Point | 177.4°C | 
| Vapour Pressur | 0.000205mmHg at 25°C | 
| MSDS | |