ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59404-75-0 5-oxo-DL-proline, compound with dodecyl DL-alaninate (1:1) |
|
| Ürün Adı | 5-oxo-DL-proline, compound with dodecyl DL-alaninate (1:1) |
| ingilizce adı | 5-oxo-DL-proline, compound with dodecyl DL-alaninate (1:1);5-Oxo-DL-proline, compound with dodecyl DL-alaninate (1:1);5-oxoproline - dodecyl alaninate (1:1) |
| Moleküler Formülü | C20H38N2O5 |
| Molekül Ağırlığı | 386.5261 |
| InChI | InChI=1/C15H31NO2.C5H7NO3/c1-3-4-5-6-7-8-9-10-11-12-13-18-15(17)14(2)16;7-4-2-1-3(6-4)5(8)9/h14H,3-13,16H2,1-2H3;3H,1-2H2,(H,6,7)(H,8,9) |
| CAS kayıt numarası | 59404-75-0 |
| EINECS | 261-737-3 |
| Moleküler Yapısı | ![]() |
| Kaynama noktası | 327.2°C at 760 mmHg |
| Alevlenme noktası | 177.4°C |
| Buhar basıncı | 0.000205mmHg at 25°C |
| MSDS | |