74772-16-0 Methyl 3-(1-pyrrolo)thiophene-2-carboxylate |
| Product Name |
Methyl 3-(1-pyrrolo)thiophene-2-carboxylate |
| Synonyms |
3-(1-Pyrrolo)thiophene-2-carboxylic acid methyl eser;methyl 3-(1H-pyrrol-1-yl)thiophene-2-carboxylate |
| Molecular Formula |
C10H9NO2S |
| Molecular Weight |
207.249 |
| InChl |
InChI=1/C10H9NO2S/c1-13-10(12)9-8(4-7-14-9)11-5-2-3-6-11/h2-7H,1H3 |
| CAS Registry Number |
74772-16-0 |
| Molecular Structure |
 |
| Density |
1.25g/cm3 |
| Boiling Point |
345.7°C at 760 mmHg |
| Refractive Index |
1.613 |
| Flash Point |
162.9°C |
| Vapour Pressur |
6.06E-05mmHg at 25°C |
| Safety Description |
S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:;
|
