ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
74772-16-0 Methyl 3-(1-pyrrolo)thiophene-2-carboxylate |
|
Produkt-Name | Methyl 3-(1-pyrrolo)thiophene-2-carboxylate |
Englischer Name | Methyl 3-(1-pyrrolo)thiophene-2-carboxylate;3-(1-Pyrrolo)thiophene-2-carboxylic acid methyl eser;methyl 3-(1H-pyrrol-1-yl)thiophene-2-carboxylate |
Molekulare Formel | C10H9NO2S |
Molecular Weight | 207.249 |
InChl | InChI=1/C10H9NO2S/c1-13-10(12)9-8(4-7-14-9)11-5-2-3-6-11/h2-7H,1H3 |
CAS Registry Number | 74772-16-0 |
Molecular Structure | ![]() |
Dichte | 1.25g/cm3 |
Siedepunkt | 345.7°C at 760 mmHg |
Brechungsindex | 1.613 |
Flammpunkt | 162.9°C |
Dampfdruck | 6.06E-05mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |