ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
74772-16-0 Methyl 3-(1-pyrrolo)thiophene-2-carboxylate |
|
اسم المنتج | Methyl 3-(1-pyrrolo)thiophene-2-carboxylate |
الاسم بالانجليزية | Methyl 3-(1-pyrrolo)thiophene-2-carboxylate;3-(1-Pyrrolo)thiophene-2-carboxylic acid methyl eser;methyl 3-(1H-pyrrol-1-yl)thiophene-2-carboxylate |
الصيغة الجزيئية | C10H9NO2S |
الوزن الجزيئي الغرامي | 207.249 |
InChI | InChI=1/C10H9NO2S/c1-13-10(12)9-8(4-7-14-9)11-5-2-3-6-11/h2-7H,1H3 |
إستراتيجية المساعدة القطرية | 74772-16-0 |
بنية جزيئية | ![]() |
كثافة | 1.25g/cm3 |
نقطة الغليان | 345.7°C at 760 mmHg |
معامل الإنكسار | 1.613 |
نقطة الوميض | 162.9°C |
ضغط البخار | 6.06E-05mmHg at 25°C |
شروط الأمن | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |