ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
81-30-1 naphthalene-1,4,5,8-tetracarboxylic acid |
|
| Chemical Name | naphthalene-1,4,5,8-tetracarboxylic acid |
| Synonyms | Naphthalene-1,4,5,8-tetracarboxylic acid dianhydride;1,4,5,8-Naphthalenetetracarboxylic dianhydride;isochromeno[6,5,4-def]isochromene-1,3,6,8-tetrone;LT-S924;NTDA |
| Molecular Formula | C14H4O6 |
| Molecular Weight | 268.178 |
| InChl | InChI=1/C14H4O6/c15-11-5-1-2-6-10-8(14(18)20-12(6)16)4-3-7(9(5)10)13(17)19-11/h1-4H |
| CAS Registry Number | 81-30-1 |
| EINECS | 201-342-5 |
| Molecular Structure | ![]() |
| Density | 1.79g/cm3 |
| Melting Point | >300℃ |
| Boiling Point | 617°C at 760 mmHg |
| Refractive Index | 1.781 |
| Flash Point | 280.4°C |
| Vapour Pressur | 3.73E-15mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R36/37/38:; |
| Safety Description | S26||S36:; |
| MSDS | |