ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
81-30-1 naphthalene-1,4,5,8-tetracarboxylic acid |
|
| Nom | naphthalene-1,4,5,8-tetracarboxylic acid |
| Nom anglais | naphthalene-1,4,5,8-tetracarboxylic acid;Naphthalene-1,4,5,8-tetracarboxylic acid dianhydride;1,4,5,8-Naphthalenetetracarboxylic dianhydride;isochromeno[6,5,4-def]isochromene-1,3,6,8-tetrone;LT-S924;NTDA |
| Formule moléculaire | C14H4O6 |
| Poids Moléculaire | 268.178 |
| InChl | InChI=1/C14H4O6/c15-11-5-1-2-6-10-8(14(18)20-12(6)16)4-3-7(9(5)10)13(17)19-11/h1-4H |
| Numéro de registre CAS | 81-30-1 |
| EINECS | 201-342-5 |
| Structure moléculaire | ![]() |
| Densité | 1.79g/cm3 |
| Point de fusion | >300℃ |
| Point d'ébullition | 617°C at 760 mmHg |
| Indice de réfraction | 1.781 |
| Point d'éclair | 280.4°C |
| Pression de vapeur | 3.73E-15mmHg at 25°C |
| Les symboles de danger | |
| Codes des risques | R36/37/38:; |
| Description de sécurité | S26||S36:; |
| MSDS | |