ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-19-0 butyl decyl phthalate |
|
| Chemical Name | butyl decyl phthalate |
| Synonyms | Phthalic acid, butyl decyl ester;1,2-Benzenedicarboxylic acid, butyl decyl ester;BRN 1999817;Butyl decyl phthalate;Decyl butyl phthalate;NSC 16200;PX 114;Plasticizer BDP;1,2-Benzenedicarboxylic acid, butyl decyl ester (9CI);butyl decyl benzene-1,2-dicarboxylate |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.503 |
| InChl | InChI=1/C22H34O4/c1-3-5-7-8-9-10-11-14-18-26-22(24)20-16-13-12-15-19(20)21(23)25-17-6-4-2/h12-13,15-16H,3-11,14,17-18H2,1-2H3 |
| CAS Registry Number | 89-19-0 |
| EINECS | 201-885-8 |
| Molecular Structure | ![]() |
| Density | 0.997g/cm3 |
| Boiling Point | 396.9°C at 760 mmHg |
| Refractive Index | 1.491 |
| Flash Point | 211.3°C |
| Vapour Pressur | 1.66E-06mmHg at 25°C |
| MSDS | |