ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-19-0 Butyl decyl phthalate |
|
| Nama produk | Butyl decyl phthalate |
| Sinonim | ;P asid hthalic, ester dekoril butil; 1,2-Benzenedicarboxylic acid, butyl decyl ester; BRN 1999817; Butyl decyl phthalate; Decyl butyl phthalate; MKN 16200; PX 114; Plasticizer BDP; 1,2-Benzenedicarboxylic acid, butyl decyl ester (9CI); Butyl decyl benzene-1,2-dicarboxylate; |
| Nama Inggeris | butyl decyl phthalate;Phthalic acid, butyl decyl ester;1,2-Benzenedicarboxylic acid, butyl decyl ester;BRN 1999817;Butyl decyl phthalate;Decyl butyl phthalate;NSC 16200;PX 114;Plasticizer BDP;1,2-Benzenedicarboxylic acid, butyl decyl ester (9CI);butyl decyl benzene-1,2-dicarboxylate |
| MF | C22H34O4 |
| Berat Molekul | 362.503 |
| InChI | InChI=1/C22H34O4/c1-3-5-7-8-9-10-11-14-18-26-22(24)20-16-13-12-15-19(20)21(23)25-17-6-4-2/h12-13,15-16H,3-11,14,17-18H2,1-2H3 |
| CAS NO | 89-19-0 |
| EINECS | 201-885-8 |
| Struktur Molekul | ![]() |
| Kepadatan | 0.997g/cm3 |
| Titik didih | 396.9°C at 760 mmHg |
| Indeks bias | 1.491 |
| Titik nyala | 211.3°C |
| Tekanan wap | 1.66E-06mmHg at 25°C |
| MSDS | |